C16H17F4NO4 — CID 120951748
(3S,4S)-1-[4-(4-fluorophenoxy)butanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 120951748) has the molecular formula C16H17F4NO4 and a molecular weight of 363.31 g/mol. Its IUPAC name is (3S,4S)-1-[4-(4-fluorophenoxy)butanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[4-(4-fluorophenoxy)butanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120951748 |
| Molecular Formula | C16H17F4NO4 |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (3S,4S)-1-[4-(4-fluorophenoxy)butanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)CCCOc2ccc(F)cc2)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C16H17F4NO4/c17-10-3-5-11(6-4-10)25-7-1-2-14(22)21-8-12(15(23)24)13(9-21)16(18,19)20/h3-6,12-13H,1-2,7-9H2,(H,23,24)/t12-,13-/m1/s1 |
| InChIKey | SNZZKZIHYVHUAQ-CHWSQXEVSA-N |
| XLogP | 2.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|