C12H18F3NO4 — CID 120951065
(3S,4S)-1-(4-ethoxybutanoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 120951065) has the molecular formula C12H18F3NO4 and a molecular weight of 297.27 g/mol. Its IUPAC name is (3S,4S)-1-(4-ethoxybutanoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(4-ethoxybutanoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120951065 |
| Molecular Formula | C12H18F3NO4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3S,4S)-1-(4-ethoxybutanoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCOCCCC(=O)N1C[C@@H](C(F)(F)F)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C12H18F3NO4/c1-2-20-5-3-4-10(17)16-6-8(11(18)19)9(7-16)12(13,14)15/h8-9H,2-7H2,1H3,(H,18,19)/t8-,9-/m1/s1 |
| InChIKey | PPJHLJROQJLQJC-RKDXNWHRSA-N |
| XLogP | 1.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|