C11H16F3NO3S — CID 120951844
(3S,4S)-1-(4-methylsulfanylbutanoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 120951844) has the molecular formula C11H16F3NO3S and a molecular weight of 299.31 g/mol. Its IUPAC name is (3S,4S)-1-(4-methylsulfanylbutanoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(4-methylsulfanylbutanoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120951844 |
| Molecular Formula | C11H16F3NO3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (3S,4S)-1-(4-methylsulfanylbutanoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CSCCCC(=O)N1C[C@@H](C(F)(F)F)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H16F3NO3S/c1-19-4-2-3-9(16)15-5-7(10(17)18)8(6-15)11(12,13)14/h7-8H,2-6H2,1H3,(H,17,18)/t7-,8-/m1/s1 |
| InChIKey | PJRCDQANMYFZSF-HTQZYQBOSA-N |
| XLogP | 1.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|