C16H16F5NO4 — CID 120950900
(3S,4S)-1-[4-(2,4-difluorophenoxy)butanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 120950900) has the molecular formula C16H16F5NO4 and a molecular weight of 381.30 g/mol. Its IUPAC name is (3S,4S)-1-[4-(2,4-difluorophenoxy)butanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[4-(2,4-difluorophenoxy)butanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120950900 |
| Molecular Formula | C16H16F5NO4 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (3S,4S)-1-[4-(2,4-difluorophenoxy)butanoyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)CCCOc2ccc(F)cc2F)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C16H16F5NO4/c17-9-3-4-13(12(18)6-9)26-5-1-2-14(23)22-7-10(15(24)25)11(8-22)16(19,20)21/h3-4,6,10-11H,1-2,5,7-8H2,(H,24,25)/t10-,11-/m1/s1 |
| InChIKey | KXPSWCHZMFOLPK-GHMZBOCLSA-N |
| XLogP | 2.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|