C18H25N3O5 — CID 119622892
1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(3-methoxy-4-nitrophenoxy)ethanone (PubChem CID 119622892) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(3-methoxy-4-nitrophenoxy)ethanone.
| Compound Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(3-methoxy-4-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 119622892 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[4-(cyclopropylmethylamino)piperidin-1-yl]-2-(3-methoxy-4-nitrophenoxy)ethanone |
| SMILES | COc1cc(OCC(=O)N2CCC(NCC3CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N3O5/c1-25-17-10-15(4-5-16(17)21(23)24)26-12-18(22)20-8-6-14(7-9-20)19-11-13-2-3-13/h4-5,10,13-14,19H,2-3,6-9,11-12H2,1H3 |
| InChIKey | AXAIVNJMXSTGHR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|