C16H24N2O5 — CID 120962037
4-[[[6-(2-methoxyethoxy)-1,3-benzodioxol-5-yl]methylamino]methyl]pyrrolidin-3-ol (PubChem CID 120962037) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[[[6-(2-methoxyethoxy)-1,3-benzodioxol-5-yl]methylamino]methyl]pyrrolidin-3-ol.
| Compound Name | 4-[[[6-(2-methoxyethoxy)-1,3-benzodioxol-5-yl]methylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 120962037 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-[[[6-(2-methoxyethoxy)-1,3-benzodioxol-5-yl]methylamino]methyl]pyrrolidin-3-ol |
| SMILES | COCCOc1cc2c(cc1CNCC1CNCC1O)OCO2 |
| InChI | InChI=1S/C16H24N2O5/c1-20-2-3-21-14-5-16-15(22-10-23-16)4-11(14)6-17-7-12-8-18-9-13(12)19/h4-5,12-13,17-19H,2-3,6-10H2,1H3 |
| InChIKey | RFQULHXUWLORKB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 81.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|