C18H21ClFN3O4 — CID 120962280
4-[[[4-(4-fluorophenoxy)-3-nitrophenyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride (PubChem CID 120962280) has the molecular formula C18H21ClFN3O4 and a molecular weight of 397.83 g/mol. Its IUPAC name is 4-[[[4-(4-fluorophenoxy)-3-nitrophenyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride.
| Compound Name | 4-[[[4-(4-fluorophenoxy)-3-nitrophenyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120962280 |
| Molecular Formula | C18H21ClFN3O4 |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-[[[4-(4-fluorophenoxy)-3-nitrophenyl]methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(CNCC2CNCC2O)ccc1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FN3O4.ClH/c19-14-2-4-15(5-3-14)26-18-6-1-12(7-16(18)22(24)25)8-20-9-13-10-21-11-17(13)23;/h1-7,13,17,20-21,23H,8-11H2;1H |
| InChIKey | QNLDTGFTFJKQCY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|