C10H13N3O4S — CID 120963858
2-[[6-(2-ethoxy-2-oxoethyl)sulfanylpyrazin-2-yl]amino]acetic acid (PubChem CID 120963858) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-[[6-(2-ethoxy-2-oxoethyl)sulfanylpyrazin-2-yl]amino]acetic acid.
| Compound Name | 2-[[6-(2-ethoxy-2-oxoethyl)sulfanylpyrazin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 120963858 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[[6-(2-ethoxy-2-oxoethyl)sulfanylpyrazin-2-yl]amino]acetic acid |
| SMILES | CCOC(=O)CSc1cncc(NCC(=O)O)n1 |
| InChI | InChI=1S/C10H13N3O4S/c1-2-17-10(16)6-18-8-4-11-3-7(13-8)12-5-9(14)15/h3-4H,2,5-6H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | HTVOTOTUHDSVLS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |