C15H25IN4O2S — CID 120973222
2-[[2-(methanesulfonamido)cyclohexyl]methyl]-1-phenylguanidine;hydroiodide (PubChem CID 120973222) has the molecular formula C15H25IN4O2S and a molecular weight of 452.36 g/mol. Its IUPAC name is 2-[[2-(methanesulfonamido)cyclohexyl]methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[[2-(methanesulfonamido)cyclohexyl]methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120973222 |
| Molecular Formula | C15H25IN4O2S |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-[[2-(methanesulfonamido)cyclohexyl]methyl]-1-phenylguanidine;hydroiodide |
| SMILES | CS(=O)(=O)NC1CCCCC1C/N=C(\N)Nc1ccccc1.I |
| InChI | InChI=1S/C15H24N4O2S.HI/c1-22(20,21)19-14-10-6-5-7-12(14)11-17-15(16)18-13-8-3-2-4-9-13;/h2-4,8-9,12,14,19H,5-7,10-11H2,1H3,(H3,16,17,18);1H |
| InChIKey | YXCUSABNHJFWJX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|