C14H19ClN2O5S — CID 120977669
2-(4-chlorophenyl)-2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]butanoic acid (PubChem CID 120977669) has the molecular formula C14H19ClN2O5S and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]butanoic acid.
| Compound Name | 2-(4-chlorophenyl)-2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120977669 |
| Molecular Formula | C14H19ClN2O5S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)CN(C)S(C)(=O)=O)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN2O5S/c1-4-14(13(19)20,10-5-7-11(15)8-6-10)16-12(18)9-17(2)23(3,21)22/h5-8H,4,9H2,1-3H3,(H,16,18)(H,19,20) |
| InChIKey | VKATXPLVHAQLHI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |