C17H23ClN2O4 — CID 120977719
2-(4-chlorophenyl)-2-[[4-oxo-4-(propylamino)butanoyl]amino]butanoic acid (PubChem CID 120977719) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[[4-oxo-4-(propylamino)butanoyl]amino]butanoic acid.
| Compound Name | 2-(4-chlorophenyl)-2-[[4-oxo-4-(propylamino)butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120977719 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[[4-oxo-4-(propylamino)butanoyl]amino]butanoic acid |
| SMILES | CCCNC(=O)CCC(=O)NC(CC)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-3-11-19-14(21)9-10-15(22)20-17(4-2,16(23)24)12-5-7-13(18)8-6-12/h5-8H,3-4,9-11H2,1-2H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | JKEKOTXVOBEYRN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |