C19H27ClN2O4 — CID 120977675
2-(4-chlorophenyl)-2-[4-(2,2-dimethylpropanoylamino)butanoylamino]butanoic acid (PubChem CID 120977675) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[4-(2,2-dimethylpropanoylamino)butanoylamino]butanoic acid.
| Compound Name | 2-(4-chlorophenyl)-2-[4-(2,2-dimethylpropanoylamino)butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 120977675 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[4-(2,2-dimethylpropanoylamino)butanoylamino]butanoic acid |
| SMILES | CCC(NC(=O)CCCNC(=O)C(C)(C)C)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H27ClN2O4/c1-5-19(17(25)26,13-8-10-14(20)11-9-13)22-15(23)7-6-12-21-16(24)18(2,3)4/h8-11H,5-7,12H2,1-4H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | JWFWZXLDHPXDEF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|