C18H24ClN3O5 — CID 120977860
2-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]-2-(4-chlorophenyl)butanoic acid (PubChem CID 120977860) has the molecular formula C18H24ClN3O5 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]-2-(4-chlorophenyl)butanoic acid.
| Compound Name | 2-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]-2-(4-chlorophenyl)butanoic acid |
|---|---|
| PubChem CID | 120977860 |
| Molecular Formula | C18H24ClN3O5 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]-2-(4-chlorophenyl)butanoic acid |
| SMILES | CCC(NC(=O)CCC(=O)NCCNC(C)=O)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClN3O5/c1-3-18(17(26)27,13-4-6-14(19)7-5-13)22-16(25)9-8-15(24)21-11-10-20-12(2)23/h4-7H,3,8-11H2,1-2H3,(H,20,23)(H,21,24)(H,22,25)(H,26,27) |
| InChIKey | YXZGIKHIBBCKHL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|