C16H24N2O4 — CID 120978735
(3R,4R)-1-[4-(cyclopropanecarbonylamino)butanoyl]-4-cyclopropylpyrrolidine-3-carboxylic acid (PubChem CID 120978735) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (3R,4R)-1-[4-(cyclopropanecarbonylamino)butanoyl]-4-cyclopropylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[4-(cyclopropanecarbonylamino)butanoyl]-4-cyclopropylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120978735 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (3R,4R)-1-[4-(cyclopropanecarbonylamino)butanoyl]-4-cyclopropylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(NCCCC(=O)N1C[C@H](C(=O)O)[C@@H](C2CC2)C1)C1CC1 |
| InChI | InChI=1S/C16H24N2O4/c19-14(2-1-7-17-15(20)11-5-6-11)18-8-12(10-3-4-10)13(9-18)16(21)22/h10-13H,1-9H2,(H,17,20)(H,21,22)/t12-,13+/m1/s1 |
| InChIKey | XLWXAHWWWVXAKQ-OLZOCXBDSA-N |
| XLogP | 0.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|