C14H22N2O5 — CID 122022397
4-[[(3R,4R)-3-cyclopropyl-4-methoxycarbonylpyrrolidine-1-carbonyl]amino]butanoic acid (PubChem CID 122022397) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-[[(3R,4R)-3-cyclopropyl-4-methoxycarbonylpyrrolidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[(3R,4R)-3-cyclopropyl-4-methoxycarbonylpyrrolidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122022397 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-[[(3R,4R)-3-cyclopropyl-4-methoxycarbonylpyrrolidine-1-carbonyl]amino]butanoic acid |
| SMILES | COC(=O)[C@H]1CN(C(=O)NCCCC(=O)O)C[C@@H]1C1CC1 |
| InChI | InChI=1S/C14H22N2O5/c1-21-13(19)11-8-16(7-10(11)9-4-5-9)14(20)15-6-2-3-12(17)18/h9-11H,2-8H2,1H3,(H,15,20)(H,17,18)/t10-,11+/m1/s1 |
| InChIKey | IWCAMUOKDDMBMU-MNOVXSKESA-N |
| XLogP | 0.69 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|