C14H22N2O4 — CID 129468614
4-[[(1S,2R,3S,6R,7S)-2-methoxy-4-azatricyclo[4.2.1.03,7]nonane-4-carbonyl]amino]butanoic acid (PubChem CID 129468614) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[[(1S,2R,3S,6R,7S)-2-methoxy-4-azatricyclo[4.2.1.03,7]nonane-4-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[(1S,2R,3S,6R,7S)-2-methoxy-4-azatricyclo[4.2.1.03,7]nonane-4-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 129468614 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-[[(1S,2R,3S,6R,7S)-2-methoxy-4-azatricyclo[4.2.1.03,7]nonane-4-carbonyl]amino]butanoic acid |
| SMILES | CO[C@@H]1[C@H]2C[C@H]3CN(C(=O)NCCCC(=O)O)[C@H]1[C@H]3C2 |
| InChI | InChI=1S/C14H22N2O4/c1-20-13-8-5-9-7-16(12(13)10(9)6-8)14(19)15-4-2-3-11(17)18/h8-10,12-13H,2-7H2,1H3,(H,15,19)(H,17,18)/t8-,9-,10-,12-,13+/m0/s1 |
| InChIKey | BTGITGQEFPIWNR-ZIIUWJBSSA-N |
| XLogP | 0.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|