C26H26F3N3O3 — CID 121000104
6-methoxy-11,11-dimethyl-9-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione (PubChem CID 121000104) has the molecular formula C26H26F3N3O3 and a molecular weight of 485.51 g/mol. Its IUPAC name is 6-methoxy-11,11-dimethyl-9-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione.
| Compound Name | 6-methoxy-11,11-dimethyl-9-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione |
|---|---|
| PubChem CID | 121000104 |
| Molecular Formula | C26H26F3N3O3 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 6-methoxy-11,11-dimethyl-9-[[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraene-2,3-dione |
| SMILES | COc1cc2c3c(c1)C(CN1CCN(c4cccc(C(F)(F)F)c4)CC1)=CC(C)(C)N3C(=O)C2=O |
| InChI | InChI=1S/C26H26F3N3O3/c1-25(2)14-16(20-12-19(35-3)13-21-22(20)32(25)24(34)23(21)33)15-30-7-9-31(10-8-30)18-6-4-5-17(11-18)26(27,28)29/h4-6,11-14H,7-10,15H2,1-3H3 |
| InChIKey | CHUBMZMBQLFCPL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|