C12H16O4 — CID 121000834
(5E)-5-(methoxymethylidene)-2-(2-methyl-1,3-dioxolan-2-yl)cyclohex-2-en-1-one (PubChem CID 121000834) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (5E)-5-(methoxymethylidene)-2-(2-methyl-1,3-dioxolan-2-yl)cyclohex-2-en-1-one.
| Compound Name | (5E)-5-(methoxymethylidene)-2-(2-methyl-1,3-dioxolan-2-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 121000834 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (5E)-5-(methoxymethylidene)-2-(2-methyl-1,3-dioxolan-2-yl)cyclohex-2-en-1-one |
| SMILES | CO/C=C1\CC=C(C2(C)OCCO2)C(=O)C1 |
| InChI | InChI=1S/C12H16O4/c1-12(15-5-6-16-12)10-4-3-9(8-14-2)7-11(10)13/h4,8H,3,5-7H2,1-2H3/b9-8+ |
| InChIKey | DQVCWPCENVCWIR-CMDGGOBGSA-N |
| XLogP | 1.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|