C12H12Cl2O5 — CID 121001883
3-(dichloromethyl)-4,5,6-trimethoxy-3H-2-benzofuran-1-one (PubChem CID 121001883) has the molecular formula C12H12Cl2O5 and a molecular weight of 307.13 g/mol. Its IUPAC name is 3-(dichloromethyl)-4,5,6-trimethoxy-3H-2-benzofuran-1-one.
| Compound Name | 3-(dichloromethyl)-4,5,6-trimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 121001883 |
| Molecular Formula | C12H12Cl2O5 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 3-(dichloromethyl)-4,5,6-trimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1cc2c(c(OC)c1OC)C(C(Cl)Cl)OC2=O |
| InChI | InChI=1S/C12H12Cl2O5/c1-16-6-4-5-7(9(18-3)8(6)17-2)10(11(13)14)19-12(5)15/h4,10-11H,1-3H3 |
| InChIKey | VGKMDAPQMIGEFZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|