C12H12Cl3N3 — CID 121002266
2,2,2-trichloro-N'-[1-(1H-indol-3-yl)ethyl]ethanimidamide (PubChem CID 121002266) has the molecular formula C12H12Cl3N3 and a molecular weight of 304.61 g/mol. Its IUPAC name is 2,2,2-trichloro-N'-[1-(1H-indol-3-yl)ethyl]ethanimidamide.
| Compound Name | 2,2,2-trichloro-N'-[1-(1H-indol-3-yl)ethyl]ethanimidamide |
|---|---|
| PubChem CID | 121002266 |
| Molecular Formula | C12H12Cl3N3 |
| Molecular Weight | 304.61 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2,2,2-trichloro-N'-[1-(1H-indol-3-yl)ethyl]ethanimidamide |
| SMILES | CC(/N=C(\N)C(Cl)(Cl)Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H12Cl3N3/c1-7(18-11(16)12(13,14)15)9-6-17-10-5-3-2-4-8(9)10/h2-7,17H,1H3,(H2,16,18) |
| InChIKey | ZFFCMOMMWAXJMA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|