C12H17BrO2 — CID 121002561
(3-bromo-7,7-dimethyl-2-bicyclo[4.1.1]oct-4-enyl) acetate (PubChem CID 121002561) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is (3-bromo-7,7-dimethyl-2-bicyclo[4.1.1]oct-4-enyl) acetate.
| Compound Name | (3-bromo-7,7-dimethyl-2-bicyclo[4.1.1]oct-4-enyl) acetate |
|---|---|
| PubChem CID | 121002561 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | (3-bromo-7,7-dimethyl-2-bicyclo[4.1.1]oct-4-enyl) acetate |
| SMILES | CC(=O)OC1C(Br)C=CC2CC1C2(C)C |
| InChI | InChI=1S/C12H17BrO2/c1-7(14)15-11-9-6-8(12(9,2)3)4-5-10(11)13/h4-5,8-11H,6H2,1-3H3 |
| InChIKey | XPKYJYJMJYCIDR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|