C13H10N4O2 — CID 121004245
1-(1,3-benzodioxol-5-yl)pyrazolo[5,4-b]pyridin-3-amine (PubChem CID 121004245) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)pyrazolo[5,4-b]pyridin-3-amine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)pyrazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 121004245 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)pyrazolo[5,4-b]pyridin-3-amine |
| SMILES | Nc1nn(-c2ccc3c(c2)OCO3)c2ncccc12 |
| InChI | InChI=1S/C13H10N4O2/c14-12-9-2-1-5-15-13(9)17(16-12)8-3-4-10-11(6-8)19-7-18-10/h1-6H,7H2,(H2,14,16) |
| InChIKey | DYALWSLOBACAEC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |