C13H10N4O3 — CID 82370247
3-(1,3-benzodioxol-5-yl)-5-(furan-2-yl)triazol-4-amine (PubChem CID 82370247) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-(furan-2-yl)triazol-4-amine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-(furan-2-yl)triazol-4-amine |
|---|---|
| PubChem CID | 82370247 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-(furan-2-yl)triazol-4-amine |
| SMILES | Nc1c(-c2ccco2)nnn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H10N4O3/c14-13-12(10-2-1-5-18-10)15-16-17(13)8-3-4-9-11(6-8)20-7-19-9/h1-6H,7,14H2 |
| InChIKey | MXOMOPMAIQYGKG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |