C14H14N4O — CID 82370391
3-(2,6-dimethylphenyl)-5-(furan-2-yl)triazol-4-amine (PubChem CID 82370391) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-5-(furan-2-yl)triazol-4-amine.
| Compound Name | 3-(2,6-dimethylphenyl)-5-(furan-2-yl)triazol-4-amine |
|---|---|
| PubChem CID | 82370391 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-5-(furan-2-yl)triazol-4-amine |
| SMILES | Cc1cccc(C)c1-n1nnc(-c2ccco2)c1N |
| InChI | InChI=1S/C14H14N4O/c1-9-5-3-6-10(2)13(9)18-14(15)12(16-17-18)11-7-4-8-19-11/h3-8H,15H2,1-2H3 |
| InChIKey | KXBBQFQEJGLBPC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |