C6H5N3OSe — CID 166447374
5-(furan-2-yl)-1,3,4-selenadiazol-2-amine (PubChem CID 166447374) has the molecular formula C6H5N3OSe and a molecular weight of 214.09 g/mol. Its IUPAC name is 5-(furan-2-yl)-1,3,4-selenadiazol-2-amine.
| Compound Name | 5-(furan-2-yl)-1,3,4-selenadiazol-2-amine |
|---|---|
| PubChem CID | 166447374 |
| Molecular Formula | C6H5N3OSe |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 5-(furan-2-yl)-1,3,4-selenadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccco2)[se]1 |
| InChI | InChI=1S/C6H5N3OSe/c7-6-9-8-5(11-6)4-2-1-3-10-4/h1-3H,(H2,7,9) |
| InChIKey | YOICDOVTSYXDMD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|