C16H15NO — CID 121005219
1-(10a,11-dihydro-10H-benzo[b][1]benzazepin-5-yl)ethanone (PubChem CID 121005219) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(10a,11-dihydro-10H-benzo[b][1]benzazepin-5-yl)ethanone.
| Compound Name | 1-(10a,11-dihydro-10H-benzo[b][1]benzazepin-5-yl)ethanone |
|---|---|
| PubChem CID | 121005219 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(10a,11-dihydro-10H-benzo[b][1]benzazepin-5-yl)ethanone |
| SMILES | CC(=O)C1=CC2=CC=CCC2Nc2ccccc21 |
| InChI | InChI=1S/C16H15NO/c1-11(18)14-10-12-6-2-4-8-15(12)17-16-9-5-3-7-13(14)16/h2-7,9-10,15,17H,8H2,1H3 |
| InChIKey | OVPXCFGPINGBQC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |