C34H38N2P2 — CID 140706592
31-methyl-7,21-di(propan-2-yl)-14,29-diaza-7,21-diphosphahexacyclo[25.3.1.05,30.08,13.015,20.023,28]hentriaconta-1,3,5(30),8,10,12,17,19,23,25,27(31),28-dodecaene (PubChem CID 140706592) has the molecular formula C34H38N2P2 and a molecular weight of 536.64 g/mol. Its IUPAC name is 31-methyl-7,21-di(propan-2-yl)-14,29-diaza-7,21-diphosphahexacyclo[25.3.1.05,30.08,13.015,20.023,28]hentriaconta-1,3,5(30),8,10,12,17,19,23,25,27(31),28-dodecaene.
| Compound Name | 31-methyl-7,21-di(propan-2-yl)-14,29-diaza-7,21-diphosphahexacyclo[25.3.1.05,30.08,13.015,20.023,28]hentriaconta-1,3,5(30),8,10,12,17,19,23,25,27(31),28-dodecaene |
|---|---|
| PubChem CID | 140706592 |
| Molecular Formula | C34H38N2P2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 31-methyl-7,21-di(propan-2-yl)-14,29-diaza-7,21-diphosphahexacyclo[25.3.1.05,30.08,13.015,20.023,28]hentriaconta-1,3,5(30),8,10,12,17,19,23,25,27(31),28-dodecaene |
| SMILES | Cc1c2cccc3c2nc2c(cccc12)CP(C(C)C)c1ccccc1NC1CC=CC=C1P(C(C)C)C3 |
| InChI | InChI=1S/C34H38N2P2/c1-22(2)37-20-25-12-10-14-27-24(5)28-15-11-13-26(34(28)36-33(25)27)21-38(23(3)4)32-19-9-7-17-30(32)35-29-16-6-8-18-31(29)37/h6-16,18-19,22-23,30,35H,17,20-21H2,1-5H3 |
| InChIKey | PIMXIOMKXLEQBB-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|