C41H44N2P2 — CID 140706609
10,18-dimethyl-14-phenyl-7,21-di(propan-2-yl)-14,29-diaza-7,21-diphosphahexacyclo[25.3.1.05,30.08,13.015,20.023,28]hentriaconta-1(31),2,4,8(13),9,11,17,19,23,25,27,29-dodecaene (PubChem CID 140706609) has the molecular formula C41H44N2P2 and a molecular weight of 626.77 g/mol. Its IUPAC name is 10,18-dimethyl-14-phenyl-7,21-di(propan-2-yl)-14,29-diaza-7,21-diphosphahexacyclo[25.3.1.05,30.08,13.015,20.023,28]hentriaconta-1(31),2,4,8(13),9,11,17,19,23,25,27,29-dodecaene.
| Compound Name | 10,18-dimethyl-14-phenyl-7,21-di(propan-2-yl)-14,29-diaza-7,21-diphosphahexacyclo[25.3.1.05,30.08,13.015,20.023,28]hentriaconta-1(31),2,4,8(13),9,11,17,19,23,25,27,29-dodecaene |
|---|---|
| PubChem CID | 140706609 |
| Molecular Formula | C41H44N2P2 |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | 10,18-dimethyl-14-phenyl-7,21-di(propan-2-yl)-14,29-diaza-7,21-diphosphahexacyclo[25.3.1.05,30.08,13.015,20.023,28]hentriaconta-1(31),2,4,8(13),9,11,17,19,23,25,27,29-dodecaene |
| SMILES | CC1=CCC2C(=C1)P(C(C)C)Cc1cccc3cc4cccc(c4nc13)CP(C(C)C)c1cc(C)ccc1N2c1ccccc1 |
| InChI | InChI=1S/C41H44N2P2/c1-27(2)44-25-33-14-10-12-31-24-32-13-11-15-34(41(32)42-40(31)33)26-45(28(3)4)39-23-30(6)19-21-37(39)43(35-16-8-7-9-17-35)36-20-18-29(5)22-38(36)44/h7-20,22-24,27-28,37H,21,25-26H2,1-6H3 |
| InChIKey | YMYDCJSXQAPIJX-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|