C17H14Cl2N2O — CID 121005807
N-(2,6-dichlorophenyl)-4-methoxy-N-methylquinolin-6-amine (PubChem CID 121005807) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-methoxy-N-methylquinolin-6-amine.
| Compound Name | N-(2,6-dichlorophenyl)-4-methoxy-N-methylquinolin-6-amine |
|---|---|
| PubChem CID | 121005807 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-methoxy-N-methylquinolin-6-amine |
| SMILES | COc1ccnc2ccc(N(C)c3c(Cl)cccc3Cl)cc12 |
| InChI | InChI=1S/C17H14Cl2N2O/c1-21(17-13(18)4-3-5-14(17)19)11-6-7-15-12(10-11)16(22-2)8-9-20-15/h3-10H,1-2H3 |
| InChIKey | IQXIXPLQQDFASE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |