C12H23NO — CID 121011035
1-(2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-benzo[b]azepin-7-yl)ethanol (PubChem CID 121011035) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-(2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-benzo[b]azepin-7-yl)ethanol.
| Compound Name | 1-(2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-benzo[b]azepin-7-yl)ethanol |
|---|---|
| PubChem CID | 121011035 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-(2,3,4,5,5a,6,7,8,9,9a-decahydro-1H-benzo[b]azepin-7-yl)ethanol |
| SMILES | CC(O)C1CCC2NCCCCC2C1 |
| InChI | InChI=1S/C12H23NO/c1-9(14)10-5-6-12-11(8-10)4-2-3-7-13-12/h9-14H,2-8H2,1H3 |
| InChIKey | IFBFNOYPWCXBCY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |