C12H12ClN3O2 — CID 121013141
6-(2-amino-5-chlorophenyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 121013141) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 6-(2-amino-5-chlorophenyl)-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-(2-amino-5-chlorophenyl)-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121013141 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 6-(2-amino-5-chlorophenyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(-c2cc(Cl)ccc2N)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C12H12ClN3O2/c1-15-10(6-11(17)16(2)12(15)18)8-5-7(13)3-4-9(8)14/h3-6H,14H2,1-2H3 |
| InChIKey | TWEFZVZUXPWXCC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|