C8H6ClN3O2 — CID 13167828
5-(2-amino-5-chlorophenyl)-3H-1,3,4-oxadiazol-2-one (PubChem CID 13167828) has the molecular formula C8H6ClN3O2 and a molecular weight of 211.61 g/mol. Its IUPAC name is 5-(2-amino-5-chlorophenyl)-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(2-amino-5-chlorophenyl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 13167828 |
| Molecular Formula | C8H6ClN3O2 |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 5-(2-amino-5-chlorophenyl)-3H-1,3,4-oxadiazol-2-one |
| SMILES | Nc1ccc(Cl)cc1-c1n[nH]c(=O)o1 |
| InChI | InChI=1S/C8H6ClN3O2/c9-4-1-2-6(10)5(3-4)7-11-12-8(13)14-7/h1-3H,10H2,(H,12,13) |
| InChIKey | AQQNTUSVGRQZKU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|