C12H9N3O3 — CID 121013526
1-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrrolidine-2,5-dione (PubChem CID 121013526) has the molecular formula C12H9N3O3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 1-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 121013526 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H9N3O3/c16-9-6-7-10(17)15(9)12-14-13-11(18-12)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | IPXNHHCIABGZNS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|