C12H21NO3 — CID 121014355
3-(2-ethylhexyl)-5-methyl-1,3-oxazolidine-2,4-dione (PubChem CID 121014355) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 3-(2-ethylhexyl)-5-methyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(2-ethylhexyl)-5-methyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 121014355 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 3-(2-ethylhexyl)-5-methyl-1,3-oxazolidine-2,4-dione |
| SMILES | CCCCC(CC)CN1C(=O)OC(C)C1=O |
| InChI | InChI=1S/C12H21NO3/c1-4-6-7-10(5-2)8-13-11(14)9(3)16-12(13)15/h9-10H,4-8H2,1-3H3 |
| InChIKey | FCHBCWUXJDLZPF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |