C13H22N2O3 — CID 21307382
1-(2-ethylhexyl)-3-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 21307382) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2-ethylhexyl)-3-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 21307382 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-(2-ethylhexyl)-3-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCC(CC)CN1C(=O)CC(=O)N(C)C1=O |
| InChI | InChI=1S/C13H22N2O3/c1-4-6-7-10(5-2)9-15-12(17)8-11(16)14(3)13(15)18/h10H,4-9H2,1-3H3 |
| InChIKey | CFTGYUPATHCTJF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|