C15H24N2O3 — CID 20502394
1-(2-ethylhexyl)-4-methyl-2,6-dioxo-3H-pyridine-5-carboxamide (PubChem CID 20502394) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-4-methyl-2,6-dioxo-3H-pyridine-5-carboxamide.
| Compound Name | 1-(2-ethylhexyl)-4-methyl-2,6-dioxo-3H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 20502394 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-(2-ethylhexyl)-4-methyl-2,6-dioxo-3H-pyridine-5-carboxamide |
| SMILES | CCCCC(CC)CN1C(=O)CC(C)=C(C(N)=O)C1=O |
| InChI | InChI=1S/C15H24N2O3/c1-4-6-7-11(5-2)9-17-12(18)8-10(3)13(14(16)19)15(17)20/h11H,4-9H2,1-3H3,(H2,16,19) |
| InChIKey | YXUSAKDICZHYNR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|