C12H10Cl2O2S — CID 121015836
(2,4-dichloro-2,3-dihydro-1-benzothiepin-5-yl) acetate (PubChem CID 121015836) has the molecular formula C12H10Cl2O2S and a molecular weight of 289.18 g/mol. Its IUPAC name is (2,4-dichloro-2,3-dihydro-1-benzothiepin-5-yl) acetate.
| Compound Name | (2,4-dichloro-2,3-dihydro-1-benzothiepin-5-yl) acetate |
|---|---|
| PubChem CID | 121015836 |
| Molecular Formula | C12H10Cl2O2S |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | (2,4-dichloro-2,3-dihydro-1-benzothiepin-5-yl) acetate |
| SMILES | CC(=O)OC1=C(Cl)CC(Cl)Sc2ccccc21 |
| InChI | InChI=1S/C12H10Cl2O2S/c1-7(15)16-12-8-4-2-3-5-10(8)17-11(14)6-9(12)13/h2-5,11H,6H2,1H3 |
| InChIKey | GHKQKUMWZGUWKR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|