C12H12N2O2 — CID 121015992
6,7,7-trimethyl-3H-pyrrolo[2,3-f][1,3]benzoxazol-2-one (PubChem CID 121015992) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 6,7,7-trimethyl-3H-pyrrolo[2,3-f][1,3]benzoxazol-2-one.
| Compound Name | 6,7,7-trimethyl-3H-pyrrolo[2,3-f][1,3]benzoxazol-2-one |
|---|---|
| PubChem CID | 121015992 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 6,7,7-trimethyl-3H-pyrrolo[2,3-f][1,3]benzoxazol-2-one |
| SMILES | CC1=Nc2cc3[nH]c(=O)oc3cc2C1(C)C |
| InChI | InChI=1S/C12H12N2O2/c1-6-12(2,3)7-4-10-9(5-8(7)13-6)14-11(15)16-10/h4-5H,1-3H3,(H,14,15) |
| InChIKey | ACMOKOBPVKXUIK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |