C15H17N3O3S — CID 121017227
3-[1-(2-benzylsulfanylacetyl)azetidin-3-yl]imidazolidine-2,4-dione (PubChem CID 121017227) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-[1-(2-benzylsulfanylacetyl)azetidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(2-benzylsulfanylacetyl)azetidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121017227 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-[1-(2-benzylsulfanylacetyl)azetidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C(CSCc1ccccc1)N1CC(N2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C15H17N3O3S/c19-13-6-16-15(21)18(13)12-7-17(8-12)14(20)10-22-9-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,16,21) |
| InChIKey | TYGAKHSUXQCCMN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|