C15H17N3O3S — CID 121017397
2-(oxan-4-ylmethoxy)-N-(1,3-thiazol-2-yl)pyridine-4-carboxamide (PubChem CID 121017397) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-(oxan-4-ylmethoxy)-N-(1,3-thiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-(oxan-4-ylmethoxy)-N-(1,3-thiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 121017397 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-(oxan-4-ylmethoxy)-N-(1,3-thiazol-2-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1nccs1)c1ccnc(OCC2CCOCC2)c1 |
| InChI | InChI=1S/C15H17N3O3S/c19-14(18-15-17-5-8-22-15)12-1-4-16-13(9-12)21-10-11-2-6-20-7-3-11/h1,4-5,8-9,11H,2-3,6-7,10H2,(H,17,18,19) |
| InChIKey | SGBFNJDQNYREAY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |