C19H15F3N2O5S — CID 121018502
N-[2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide (PubChem CID 121018502) has the molecular formula C19H15F3N2O5S and a molecular weight of 440.40 g/mol. Its IUPAC name is N-[2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide.
| Compound Name | N-[2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide |
|---|---|
| PubChem CID | 121018502 |
| Molecular Formula | C19H15F3N2O5S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | N-[2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-N'-[4-(trifluoromethoxy)phenyl]oxamide |
| SMILES | O=C(NCC(O)(c1ccoc1)c1cccs1)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N2O5S/c20-19(21,22)29-14-5-3-13(4-6-14)24-17(26)16(25)23-11-18(27,12-7-8-28-10-12)15-2-1-9-30-15/h1-10,27H,11H2,(H,23,25)(H,24,26) |
| InChIKey | YWLXAERNBIDRBA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|