C20H22N2O4S — CID 124892626
1-[(2S)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-3-[2-(4-methoxyphenyl)ethyl]urea (PubChem CID 124892626) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 1-[(2S)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-3-[2-(4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[(2S)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-3-[2-(4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 124892626 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-[(2S)-2-(furan-3-yl)-2-hydroxy-2-thiophen-2-ylethyl]-3-[2-(4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NC[C@@](O)(c2ccoc2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H22N2O4S/c1-25-17-6-4-15(5-7-17)8-10-21-19(23)22-14-20(24,16-9-11-26-13-16)18-3-2-12-27-18/h2-7,9,11-13,24H,8,10,14H2,1H3,(H2,21,22,23)/t20-/m1/s1 |
| InChIKey | UGBPQVCFMQTEQY-HXUWFJFHSA-N |
| XLogP | 3.13 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |