C17H18N4O7 — CID 121025490
N-(2-methoxy-5-nitrophenyl)-2,4-dioxo-3-(oxolan-2-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 121025490) has the molecular formula C17H18N4O7 and a molecular weight of 390.35 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2,4-dioxo-3-(oxolan-2-ylmethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2,4-dioxo-3-(oxolan-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121025490 |
| Molecular Formula | C17H18N4O7 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2,4-dioxo-3-(oxolan-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1c[nH]c(=O)n(CC2CCCO2)c1=O |
| InChI | InChI=1S/C17H18N4O7/c1-27-14-5-4-10(21(25)26)7-13(14)19-15(22)12-8-18-17(24)20(16(12)23)9-11-3-2-6-28-11/h4-5,7-8,11H,2-3,6,9H2,1H3,(H,18,24)(H,19,22) |
| InChIKey | DGGZJXYMCJXWJS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 145.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|