C16H15ClN4O6 — CID 121025570
N-(2-chloro-4-nitrophenyl)-2,4-dioxo-3-(oxolan-2-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 121025570) has the molecular formula C16H15ClN4O6 and a molecular weight of 394.77 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2,4-dioxo-3-(oxolan-2-ylmethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2,4-dioxo-3-(oxolan-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121025570 |
| Molecular Formula | C16H15ClN4O6 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2,4-dioxo-3-(oxolan-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1c[nH]c(=O)n(CC2CCCO2)c1=O |
| InChI | InChI=1S/C16H15ClN4O6/c17-12-6-9(21(25)26)3-4-13(12)19-14(22)11-7-18-16(24)20(15(11)23)8-10-2-1-5-27-10/h3-4,6-7,10H,1-2,5,8H2,(H,18,24)(H,19,22) |
| InChIKey | PIGPMMYKZFOUTN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 136.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|