C20H16ClN3O6 — CID 17362239
2-chloro-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-5-nitrobenzamide (PubChem CID 17362239) has the molecular formula C20H16ClN3O6 and a molecular weight of 429.82 g/mol. Its IUPAC name is 2-chloro-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 17362239 |
| Molecular Formula | C20H16ClN3O6 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-chloro-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C20H16ClN3O6/c21-17-6-4-12(24(28)29)9-16(17)18(25)22-11-3-5-14-15(8-11)20(27)23(19(14)26)10-13-2-1-7-30-13/h3-6,8-9,13H,1-2,7,10H2,(H,22,25) |
| InChIKey | YQWJUJPEBXCXOX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|