C21H18N4O9 — CID 17359039
2-(2,4-dinitrophenoxy)-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]acetamide (PubChem CID 17359039) has the molecular formula C21H18N4O9 and a molecular weight of 470.39 g/mol. Its IUPAC name is 2-(2,4-dinitrophenoxy)-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]acetamide.
| Compound Name | 2-(2,4-dinitrophenoxy)-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 17359039 |
| Molecular Formula | C21H18N4O9 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-(2,4-dinitrophenoxy)-N-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Nc1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C21H18N4O9/c26-19(11-34-18-6-4-13(24(29)30)9-17(18)25(31)32)22-12-3-5-15-16(8-12)21(28)23(20(15)27)10-14-2-1-7-33-14/h3-6,8-9,14H,1-2,7,10-11H2,(H,22,26) |
| InChIKey | VJQARKQLFOJHCE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|