C25H30O3 — CID 12109974
1,2,3-Trimethoxy-4,7,12-trimethyl-9-propan-2-ylbenzo[a]heptalene (PubChem CID 12109974) has the molecular formula C25H30O3 and a molecular weight of 378.50 g/mol. Its IUPAC name is 1,2,3-trimethoxy-4,7,12-trimethyl-9-propan-2-ylbenzo[a]heptalene.
| Compound Name | 1,2,3-Trimethoxy-4,7,12-trimethyl-9-propan-2-ylbenzo[a]heptalene |
|---|---|
| PubChem CID | 12109974 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1,2,3-trimethoxy-4,7,12-trimethyl-9-propan-2-ylbenzo[a]heptalene |
| SMILES | CC1=CC=C2C(=C(C(=C(C2=C3C1=CC(=CC=C3C)C(C)C)OC)OC)OC)C |
| InChI | InChI=1S/C25H30O3/c1-14(2)18-11-9-16(4)21-20(13-18)15(3)10-12-19-17(5)23(26-6)25(28-8)24(27-7)22(19)21/h9-14H,1-8H3 |
| InChIKey | JKLFPNNARZNHHP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | 954 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |