C17H28O2 — CID 143504986
ethane;(5Z,6E)-1-(2-ethoxyethoxy)-5,6-di(ethylidene)-4-methylcyclohexa-1,3-diene (PubChem CID 143504986) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;(5Z,6E)-1-(2-ethoxyethoxy)-5,6-di(ethylidene)-4-methylcyclohexa-1,3-diene.
| Compound Name | ethane;(5Z,6E)-1-(2-ethoxyethoxy)-5,6-di(ethylidene)-4-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143504986 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | ethane;(5Z,6E)-1-(2-ethoxyethoxy)-5,6-di(ethylidene)-4-methylcyclohexa-1,3-diene |
| SMILES | C/C=c1/c(C)ccc(OCCOCC)/c1=C/C.CC |
| InChI | InChI=1S/C15H22O2.C2H6/c1-5-13-12(4)8-9-15(14(13)6-2)17-11-10-16-7-3;1-2/h5-6,8-9H,7,10-11H2,1-4H3;1-2H3/b13-5-,14-6+; |
| InChIKey | AENRGPGTEWFMFS-QJXNMKMUSA-N |
| XLogP | 3.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|