C24H31N3O5S — CID 121109551
4-(4-methoxyphenyl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxane-4-carboxamide (PubChem CID 121109551) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxane-4-carboxamide.
| Compound Name | 4-(4-methoxyphenyl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 121109551 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]oxane-4-carboxamide |
| SMILES | COc1ccc(C2(C(=O)NCC3CCN(S(=O)(=O)c4cccnc4)CC3)CCOCC2)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-31-21-6-4-20(5-7-21)24(10-15-32-16-11-24)23(28)26-17-19-8-13-27(14-9-19)33(29,30)22-3-2-12-25-18-22/h2-7,12,18-19H,8-11,13-17H2,1H3,(H,26,28) |
| InChIKey | AETLXDUCGMPBRP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |