C18H22N4O4S — CID 90521554
1-methyl-2-oxo-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]pyridine-3-carboxamide (PubChem CID 90521554) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-methyl-2-oxo-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 1-methyl-2-oxo-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90521554 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-methyl-2-oxo-N-[(1-pyridin-3-ylsulfonylpiperidin-4-yl)methyl]pyridine-3-carboxamide |
| SMILES | Cn1cccc(C(=O)NCC2CCN(S(=O)(=O)c3cccnc3)CC2)c1=O |
| InChI | InChI=1S/C18H22N4O4S/c1-21-9-3-5-16(18(21)24)17(23)20-12-14-6-10-22(11-7-14)27(25,26)15-4-2-8-19-13-15/h2-5,8-9,13-14H,6-7,10-12H2,1H3,(H,20,23) |
| InChIKey | TVDQYQYZESLFGZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |